About CID 123432864
CID 123432864 (PubChem CID 123432864) has the molecular formula C57H42F6N4O2+2
and a molecular weight of 928.98 g/mol.
Molecular Properties
| Compound Name | CID 123432864 |
| PubChem CID | 123432864 |
| Molecular Formula | C57H42F6N4O2+2 |
| Molecular Weight | 928.98 g/mol |
| Exact Mass | 928.32 |
| IUPAC Name | — |
| SMILES | CC1CC(C)OC2(CC3(C[n+]4cc(C(F)(F)F)ccc4-c4ccc5c(c43)c3ccccc3n5-c3ccccc3)O1)c1c(ccc3c1c1ccccc1n3-c1ccccc1)-c1ccc(C(F)(F)F)c[n+]12 |
| InChI | InChI=1S/C57H42F6N4O2/c1-34-29-35(2)69-55(53-43(45-26-22-37(31-65(45)55)57(61,62)63)24-28-49-51(53)41-18-10-12-20-47(41)67(49)39-15-7-4-8-16-39)32-54(68-34)33-64-30-36(56(58,59)60)21-25-44(64)42-23-27-48-50(52(42)54)40-17-9-11-19-46(40)66(48)38-13-5-3-6-14-38/h3-28,30-31,34-35H,29,32-33H2,1-2H3/q+2 |
| InChIKey | WXIPFJVKJQSONK-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 928.98 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 123432864 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123432864?
The IUPAC name of CID 123432864 (CID 123432864) is not available.
What is the SMILES notation for CID 123432864?
The canonical SMILES for CID 123432864 is CC1CC(C)OC2(CC3(C[n+]4cc(C(F)(F)F)ccc4-c4ccc5c(c43)c3ccccc3n5-c3ccccc3)O1)c1c(ccc3c1c1ccccc1n3-c1ccccc1)-c1ccc(C(F)(F)F)c[n+]12.
What is the InChIKey of CID 123432864?
The InChIKey is WXIPFJVKJQSONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H42F6N4O2/c1-34-29-35(2)69-55(53-43(45-26-22-37(31-65(45)55)57(61,62)63)24-28-49-51(53)41-18-10-12-20-47(41)67(49)39-15-7-4-8-16-39)32-54(68-34)33-64-30-36(56(58,59)60)21-25-44(64)42-23-27-48-50(52(42)54)40-17-9-11-19-46(40)66(48)38-13-5-3-6-14-38/h3-28,30-31,34-35H,29,32-33H2,1-2H3/q+2.
What are the key properties of CID 123432864?
CID 123432864 has a molecular weight of 928.98 g/mol, XLogP of 13.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123432864 is sourced from PubChem (CID 123432864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).