C45H82N4O8 — CID 123432881
1-O-[3-methyl-3-(2-methylbutan-2-ylamino)butyl] 2-O,3-O,4-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 123432881) has the molecular formula C45H82N4O8 and a molecular weight of 807.17 g/mol. Its IUPAC name is 1-O-[3-methyl-3-(2-methylbutan-2-ylamino)butyl] 2-O,3-O,4-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | 1-O-[3-methyl-3-(2-methylbutan-2-ylamino)butyl] 2-O,3-O,4-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 123432881 |
| Molecular Formula | C45H82N4O8 |
| Molecular Weight | 807.17 g/mol |
| Exact Mass | 806.61 |
| IUPAC Name | 1-O-[3-methyl-3-(2-methylbutan-2-ylamino)butyl] 2-O,3-O,4-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | CCC(C)(C)NC(C)(C)CCOC(=O)CC(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(CC(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C45H82N4O8/c1-18-38(2,3)46-39(4,5)19-20-54-34(50)21-32(36(52)56-30-25-42(10,11)48-43(12,13)26-30)33(37(53)57-31-27-44(14,15)49-45(16,17)28-31)22-35(51)55-29-23-40(6,7)47-41(8,9)24-29/h29-33,46-49H,18-28H2,1-17H3 |
| InChIKey | WZVJONOFSYGAAF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.17 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|