About 2-methylocta-1,4-dien-6-yn-3-imine
2-methylocta-1,4-dien-6-yn-3-imine (PubChem CID 123433130) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-methylocta-1,4-dien-6-yn-3-imine.
Molecular Properties
| Compound Name | 2-methylocta-1,4-dien-6-yn-3-imine |
| PubChem CID | 123433130 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2-methylocta-1,4-dien-6-yn-3-imine |
| SMILES | [H]/N=C(\C=CC#CC)C(=C)C |
| InChI | InChI=1S/C9H11N/c1-4-5-6-7-9(10)8(2)3/h6-7,10H,2H2,1,3H3/b7-6?,10-9+ |
| InChIKey | QWOLVDJNVCTNMO-VGAVRCOMSA-N |
| XLogP | 2.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylocta-1,4-dien-6-yn-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylocta-1,4-dien-6-yn-3-imine?
The IUPAC name of 2-methylocta-1,4-dien-6-yn-3-imine (CID 123433130) is 2-methylocta-1,4-dien-6-yn-3-imine.
What is the SMILES notation for 2-methylocta-1,4-dien-6-yn-3-imine?
The canonical SMILES for 2-methylocta-1,4-dien-6-yn-3-imine is [H]/N=C(\C=CC#CC)C(=C)C.
What is the InChIKey of 2-methylocta-1,4-dien-6-yn-3-imine?
The InChIKey is QWOLVDJNVCTNMO-VGAVRCOMSA-N. The full InChI is InChI=1S/C9H11N/c1-4-5-6-7-9(10)8(2)3/h6-7,10H,2H2,1,3H3/b7-6?,10-9+.
What are the key properties of 2-methylocta-1,4-dien-6-yn-3-imine?
2-methylocta-1,4-dien-6-yn-3-imine has a molecular weight of 133.19 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylocta-1,4-dien-6-yn-3-imine is sourced from PubChem (CID 123433130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).