About (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium
(8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium (PubChem CID 123433478) has the molecular formula C15H31N2+
and a molecular weight of 239.43 g/mol. Its IUPAC name is (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium.
Molecular Properties
| Compound Name | (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium |
| PubChem CID | 123433478 |
| Molecular Formula | C15H31N2+ |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.25 |
| IUPAC Name | (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium |
| SMILES | CCCC=C(C=CC(C)C(C)C)N[N+](C)(C)C |
| InChI | InChI=1S/C15H31N2/c1-8-9-10-15(16-17(5,6)7)12-11-14(4)13(2)3/h10-14,16H,8-9H2,1-7H3/q+1 |
| InChIKey | IFYHDVNPEILGQL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium?
The IUPAC name of (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium (CID 123433478) is (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium.
What is the SMILES notation for (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium?
The canonical SMILES for (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium is CCCC=C(C=CC(C)C(C)C)N[N+](C)(C)C.
What is the InChIKey of (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium?
The InChIKey is IFYHDVNPEILGQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N2/c1-8-9-10-15(16-17(5,6)7)12-11-14(4)13(2)3/h10-14,16H,8-9H2,1-7H3/q+1.
What are the key properties of (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium?
(8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium has a molecular weight of 239.43 g/mol, XLogP of 3.73, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8,9-dimethyldeca-4,6-dien-5-ylamino)-trimethylazanium is sourced from PubChem (CID 123433478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).