C20H24FN5O2S — CID 123434021
2-[5-fluoro-6-[4-[hydroxy-[(6-methyl-1,3-benzothiazol-2-yl)amino]methyl]piperazin-1-yl]-3-pyridinyl]ethanol (PubChem CID 123434021) has the molecular formula C20H24FN5O2S and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[5-fluoro-6-[4-[hydroxy-[(6-methyl-1,3-benzothiazol-2-yl)amino]methyl]piperazin-1-yl]-3-pyridinyl]ethanol.
| Compound Name | 2-[5-fluoro-6-[4-[hydroxy-[(6-methyl-1,3-benzothiazol-2-yl)amino]methyl]piperazin-1-yl]-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 123434021 |
| Molecular Formula | C20H24FN5O2S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2-[5-fluoro-6-[4-[hydroxy-[(6-methyl-1,3-benzothiazol-2-yl)amino]methyl]piperazin-1-yl]-3-pyridinyl]ethanol |
| SMILES | Cc1ccc2nc(NC(O)N3CCN(c4ncc(CCO)cc4F)CC3)sc2c1 |
| InChI | InChI=1S/C20H24FN5O2S/c1-13-2-3-16-17(10-13)29-19(23-16)24-20(28)26-7-5-25(6-8-26)18-15(21)11-14(4-9-27)12-22-18/h2-3,10-12,20,27-28H,4-9H2,1H3,(H,23,24) |
| InChIKey | FKTFNVHIQANOJA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|