C13H18F4N3O4PS — CID 123434348
1-[4a-(difluoromethyl)-7,7-difluoro-2-propan-2-yloxy-2-sulfanylidene-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2H-pyrimidin-4-amine (PubChem CID 123434348) has the molecular formula C13H18F4N3O4PS and a molecular weight of 419.34 g/mol. Its IUPAC name is 1-[4a-(difluoromethyl)-7,7-difluoro-2-propan-2-yloxy-2-sulfanylidene-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2H-pyrimidin-4-amine.
| Compound Name | 1-[4a-(difluoromethyl)-7,7-difluoro-2-propan-2-yloxy-2-sulfanylidene-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2H-pyrimidin-4-amine |
|---|---|
| PubChem CID | 123434348 |
| Molecular Formula | C13H18F4N3O4PS |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 1-[4a-(difluoromethyl)-7,7-difluoro-2-propan-2-yloxy-2-sulfanylidene-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2H-pyrimidin-4-amine |
| SMILES | CC(C)OP1(=S)OCC2(C(F)F)OC(N3C=CC(N)=NC3)C(F)(F)C2O1 |
| InChI | InChI=1S/C13H18F4N3O4PS/c1-7(2)23-25(26)21-5-12(10(14)15)9(24-25)13(16,17)11(22-12)20-4-3-8(18)19-6-20/h3-4,7,9-11H,5-6H2,1-2H3,(H2,18,19) |
| InChIKey | PCCGDWBACWADKL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|