C27H40O2 — CID 123434870
1-[1-(cyclohexylmethoxy)ethoxy]-5-(2,2,4-trimethylpentan-3-yl)naphthalene (PubChem CID 123434870) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-[1-(cyclohexylmethoxy)ethoxy]-5-(2,2,4-trimethylpentan-3-yl)naphthalene.
| Compound Name | 1-[1-(cyclohexylmethoxy)ethoxy]-5-(2,2,4-trimethylpentan-3-yl)naphthalene |
|---|---|
| PubChem CID | 123434870 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1-[1-(cyclohexylmethoxy)ethoxy]-5-(2,2,4-trimethylpentan-3-yl)naphthalene |
| SMILES | CC(OCC1CCCCC1)Oc1cccc2c(C(C(C)C)C(C)(C)C)cccc12 |
| InChI | InChI=1S/C27H40O2/c1-19(2)26(27(4,5)6)24-16-10-15-23-22(24)14-11-17-25(23)29-20(3)28-18-21-12-8-7-9-13-21/h10-11,14-17,19-21,26H,7-9,12-13,18H2,1-6H3 |
| InChIKey | KMIVTPNAYXLLPV-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|