C22H24FN3O4 — CID 123435157
12-(2-fluoroethyl)-5,10,18-trihydroxy-4,12-diazahexacyclo[12.6.1.01,10.03,8.011,14.015,20]henicosa-3,7,15(20),16,18-pentaene-6-carboxamide (PubChem CID 123435157) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 12-(2-fluoroethyl)-5,10,18-trihydroxy-4,12-diazahexacyclo[12.6.1.01,10.03,8.011,14.015,20]henicosa-3,7,15(20),16,18-pentaene-6-carboxamide.
| Compound Name | 12-(2-fluoroethyl)-5,10,18-trihydroxy-4,12-diazahexacyclo[12.6.1.01,10.03,8.011,14.015,20]henicosa-3,7,15(20),16,18-pentaene-6-carboxamide |
|---|---|
| PubChem CID | 123435157 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 12-(2-fluoroethyl)-5,10,18-trihydroxy-4,12-diazahexacyclo[12.6.1.01,10.03,8.011,14.015,20]henicosa-3,7,15(20),16,18-pentaene-6-carboxamide |
| SMILES | NC(=O)C1C=C2CC3(O)C4N(CCF)CC45CC3(CC2=NC1O)c1cc(O)ccc15 |
| InChI | InChI=1S/C22H24FN3O4/c23-3-4-26-10-20-9-21(15-6-12(27)1-2-14(15)20)8-16-11(7-22(21,30)19(20)26)5-13(17(24)28)18(29)25-16/h1-2,5-6,13,18-19,27,29-30H,3-4,7-10H2,(H2,24,28) |
| InChIKey | FAILMZCWLMKCMR-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |