About 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine
6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine (PubChem CID 123435714) has the molecular formula C11H15ClFN
and a molecular weight of 215.70 g/mol. Its IUPAC name is 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine.
Molecular Properties
| Compound Name | 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine |
| PubChem CID | 123435714 |
| Molecular Formula | C11H15ClFN |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine |
| SMILES | C=C(C)C(=C)/C(C=C(Cl)C(C)F)=N/C |
| InChI | InChI=1S/C11H15ClFN/c1-7(2)8(3)11(14-5)6-10(12)9(4)13/h6,9H,1,3H2,2,4-5H3/b10-6?,14-11+ |
| InChIKey | JGGSYJQHONOJFG-NBVHASRLSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine?
The IUPAC name of 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine (CID 123435714) is 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine.
What is the SMILES notation for 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine?
The canonical SMILES for 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine is C=C(C)C(=C)/C(C=C(Cl)C(C)F)=N/C.
What is the InChIKey of 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine?
The InChIKey is JGGSYJQHONOJFG-NBVHASRLSA-N. The full InChI is InChI=1S/C11H15ClFN/c1-7(2)8(3)11(14-5)6-10(12)9(4)13/h6,9H,1,3H2,2,4-5H3/b10-6?,14-11+.
What are the key properties of 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine?
6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine has a molecular weight of 215.70 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-fluoro-N,2-dimethyl-3-methylideneocta-1,5-dien-4-imine is sourced from PubChem (CID 123435714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).