C30H30F3N3O7 — CID 123436025
(4S,4aS,5aR,12aS)-8-[(benzylamino)methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123436025) has the molecular formula C30H30F3N3O7 and a molecular weight of 601.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-8-[(benzylamino)methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-8-[(benzylamino)methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123436025 |
| Molecular Formula | C30H30F3N3O7 |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | (4S,4aS,5aR,12aS)-8-[(benzylamino)methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)cc(CNCc5ccccc5)c(C(F)(F)F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H30F3N3O7/c1-36(2)23-17-9-14-8-16-20(24(38)19(14)26(40)29(17,43)27(41)21(25(23)39)28(34)42)18(37)10-15(22(16)30(31,32)33)12-35-11-13-6-4-3-5-7-13/h3-7,10,14,17,19,21,23,35,37,43H,8-9,11-12H2,1-2H3,(H2,34,42)/t14-,17-,19?,21?,23-,29-/m0/s1 |
| InChIKey | FSZPQGXERVEDRZ-IAMYIRAESA-N |
| XLogP | 1.18 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|