C11H21F3N2O — CID 123436184
4-N-(2-ethoxy-3,3,3-trifluoropropyl)cyclohexane-1,4-diamine (PubChem CID 123436184) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 4-N-(2-ethoxy-3,3,3-trifluoropropyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(2-ethoxy-3,3,3-trifluoropropyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123436184 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-N-(2-ethoxy-3,3,3-trifluoropropyl)cyclohexane-1,4-diamine |
| SMILES | CCOC(CNC1CCC(N)CC1)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O/c1-2-17-10(11(12,13)14)7-16-9-5-3-8(15)4-6-9/h8-10,16H,2-7,15H2,1H3 |
| InChIKey | GVDPRKJFWHXHPD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |