C22H36O3 — CID 123436435
(4aR,7S,8S,8aR)-4,7,8a-trimethyl-8-[(3R)-3-methylpentyl]-3,4a,5,6,7,8-hexahydro-2H-naphthalene-1,1,4-tricarbaldehyde (PubChem CID 123436435) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (4aR,7S,8S,8aR)-4,7,8a-trimethyl-8-[(3R)-3-methylpentyl]-3,4a,5,6,7,8-hexahydro-2H-naphthalene-1,1,4-tricarbaldehyde.
| Compound Name | (4aR,7S,8S,8aR)-4,7,8a-trimethyl-8-[(3R)-3-methylpentyl]-3,4a,5,6,7,8-hexahydro-2H-naphthalene-1,1,4-tricarbaldehyde |
|---|---|
| PubChem CID | 123436435 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (4aR,7S,8S,8aR)-4,7,8a-trimethyl-8-[(3R)-3-methylpentyl]-3,4a,5,6,7,8-hexahydro-2H-naphthalene-1,1,4-tricarbaldehyde |
| SMILES | CC[C@@H](C)CC[C@H]1[C@@H](C)CC[C@H]2C(C)(C=O)CCC(C=O)(C=O)[C@]12C |
| InChI | InChI=1S/C22H36O3/c1-6-16(2)7-9-18-17(3)8-10-19-20(4,13-23)11-12-22(14-24,15-25)21(18,19)5/h13-19H,6-12H2,1-5H3/t16-,17+,18+,19+,20?,21-/m1/s1 |
| InChIKey | PDNCZORDCLKNSR-YEKHCKQHSA-N |
| XLogP | 4.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|