About N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine
N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine (PubChem CID 123436615) has the molecular formula C13H21F2N3
and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine |
| PubChem CID | 123436615 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine |
| SMILES | Cc1nc(C(C)NCC(F)F)nc(C)c1C(C)C |
| InChI | InChI=1S/C13H21F2N3/c1-7(2)12-8(3)17-13(18-9(12)4)10(5)16-6-11(14)15/h7,10-11,16H,6H2,1-5H3 |
| InChIKey | PSOONEFELQLAMJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine?
The IUPAC name of N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine (CID 123436615) is N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine.
What is the SMILES notation for N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine?
The canonical SMILES for N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine is Cc1nc(C(C)NCC(F)F)nc(C)c1C(C)C.
What is the InChIKey of N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine?
The InChIKey is PSOONEFELQLAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F2N3/c1-7(2)12-8(3)17-13(18-9(12)4)10(5)16-6-11(14)15/h7,10-11,16H,6H2,1-5H3.
What are the key properties of N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine?
N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine has a molecular weight of 257.33 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4,6-dimethyl-5-propan-2-ylpyrimidin-2-yl)ethyl]-2,2-difluoroethanamine is sourced from PubChem (CID 123436615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).