About 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol
3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol (PubChem CID 123436674) has the molecular formula C9H10F6O
and a molecular weight of 248.17 g/mol. Its IUPAC name is 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol.
Molecular Properties
| Compound Name | 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol |
| PubChem CID | 123436674 |
| Molecular Formula | C9H10F6O |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol |
| SMILES | C=CC(=CCC)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10F6O/c1-3-5-6(4-2)7(16,8(10,11)12)9(13,14)15/h4-5,16H,2-3H2,1H3 |
| InChIKey | MXFINCYPQUCBAY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol?
The IUPAC name of 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol (CID 123436674) is 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol.
What is the SMILES notation for 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol?
The canonical SMILES for 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol is C=CC(=CCC)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol?
The InChIKey is MXFINCYPQUCBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F6O/c1-3-5-6(4-2)7(16,8(10,11)12)9(13,14)15/h4-5,16H,2-3H2,1H3.
What are the key properties of 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol?
3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol has a molecular weight of 248.17 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,1,1-trifluoro-2-(trifluoromethyl)hex-3-en-2-ol is sourced from PubChem (CID 123436674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).