C22H32O3 — CID 123436790
8-(methoxymethyl)-3a-methyl-7-(2-oxohex-3-enylidene)-1,2,4,5,5a,6,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-one (PubChem CID 123436790) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 8-(methoxymethyl)-3a-methyl-7-(2-oxohex-3-enylidene)-1,2,4,5,5a,6,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-one.
| Compound Name | 8-(methoxymethyl)-3a-methyl-7-(2-oxohex-3-enylidene)-1,2,4,5,5a,6,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-one |
|---|---|
| PubChem CID | 123436790 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 8-(methoxymethyl)-3a-methyl-7-(2-oxohex-3-enylidene)-1,2,4,5,5a,6,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-one |
| SMILES | CCC=CC(=O)C=C1CC2CCC3(C)C(=O)CCC3C2CC1COC |
| InChI | InChI=1S/C22H32O3/c1-4-5-6-18(23)12-16-11-15-9-10-22(2)20(7-8-21(22)24)19(15)13-17(16)14-25-3/h5-6,12,15,17,19-20H,4,7-11,13-14H2,1-3H3 |
| InChIKey | NHSPUVLYKLQNSR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|