C22H44FN5O2 — CID 123436808
3,3-diamino-N-(4-ethoxypiperidin-3-yl)-2-(4-ethyl-8-fluoro-1,4-dimethylazonan-2-yl)propanamide (PubChem CID 123436808) has the molecular formula C22H44FN5O2 and a molecular weight of 429.63 g/mol. Its IUPAC name is 3,3-diamino-N-(4-ethoxypiperidin-3-yl)-2-(4-ethyl-8-fluoro-1,4-dimethylazonan-2-yl)propanamide.
| Compound Name | 3,3-diamino-N-(4-ethoxypiperidin-3-yl)-2-(4-ethyl-8-fluoro-1,4-dimethylazonan-2-yl)propanamide |
|---|---|
| PubChem CID | 123436808 |
| Molecular Formula | C22H44FN5O2 |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.35 |
| IUPAC Name | 3,3-diamino-N-(4-ethoxypiperidin-3-yl)-2-(4-ethyl-8-fluoro-1,4-dimethylazonan-2-yl)propanamide |
| SMILES | CCOC1CCNCC1NC(=O)C(C(N)N)C1CC(C)(CC)CCCC(F)CN1C |
| InChI | InChI=1S/C22H44FN5O2/c1-5-22(3)10-7-8-15(23)14-28(4)17(12-22)19(20(24)25)21(29)27-16-13-26-11-9-18(16)30-6-2/h15-20,26H,5-14,24-25H2,1-4H3,(H,27,29) |
| InChIKey | WPYYBKJPUPTZLS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|