C46H30N5+ — CID 123437295
11-(4,6-diphenylpyrimidin-2-yl)-20-phenyl-1,11-diaza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),3,5,7,9,12,15(27),16,18,20,22,24-dodecaene (PubChem CID 123437295) has the molecular formula C46H30N5+ and a molecular weight of 652.78 g/mol. Its IUPAC name is 11-(4,6-diphenylpyrimidin-2-yl)-20-phenyl-1,11-diaza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),3,5,7,9,12,15(27),16,18,20,22,24-dodecaene.
| Compound Name | 11-(4,6-diphenylpyrimidin-2-yl)-20-phenyl-1,11-diaza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),3,5,7,9,12,15(27),16,18,20,22,24-dodecaene |
|---|---|
| PubChem CID | 123437295 |
| Molecular Formula | C46H30N5+ |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | 11-(4,6-diphenylpyrimidin-2-yl)-20-phenyl-1,11-diaza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),3,5,7,9,12,15(27),16,18,20,22,24-dodecaene |
| SMILES | C1=CC2=[N+](c3ccccc3)c3cccc4c5cc6c(cc5n(c34)C2C=C1)c1ccccc1n6-c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C46H30N5/c1-4-15-30(16-5-1)37-29-38(31-17-6-2-7-18-31)48-46(47-37)51-39-23-11-10-21-33(39)35-27-43-36(28-44(35)51)34-22-14-26-42-45(34)50(43)41-25-13-12-24-40(41)49(42)32-19-8-3-9-20-32/h1-29,41H/q+1 |
| InChIKey | PCGSLNDTZXAKJO-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 38.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|