C31H25F3N8O2S4 — CID 123437413
N-[4-[5-[5-(2-anilino-2-oxoethyl)sulfanyl-4-ethyl-1,2,4-triazol-3-yl]thiophen-2-yl]phenyl]-3,3,3-trifluoro-2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 123437413) has the molecular formula C31H25F3N8O2S4 and a molecular weight of 726.86 g/mol. Its IUPAC name is N-[4-[5-[5-(2-anilino-2-oxoethyl)sulfanyl-4-ethyl-1,2,4-triazol-3-yl]thiophen-2-yl]phenyl]-3,3,3-trifluoro-2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-[4-[5-[5-(2-anilino-2-oxoethyl)sulfanyl-4-ethyl-1,2,4-triazol-3-yl]thiophen-2-yl]phenyl]-3,3,3-trifluoro-2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 123437413 |
| Molecular Formula | C31H25F3N8O2S4 |
| Molecular Weight | 726.86 g/mol |
| Exact Mass | 726.09 |
| IUPAC Name | N-[4-[5-[5-(2-anilino-2-oxoethyl)sulfanyl-4-ethyl-1,2,4-triazol-3-yl]thiophen-2-yl]phenyl]-3,3,3-trifluoro-2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CCn1c(SCC(=O)Nc2ccccc2)nnc1-c1ccc(-c2ccc(NC(=O)C(Sc3n[nH]c(-c4cccs4)n3)C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C31H25F3N8O2S4/c1-2-42-27(39-41-30(42)46-17-24(43)35-19-7-4-3-5-8-19)23-15-14-21(47-23)18-10-12-20(13-11-18)36-28(44)25(31(32,33)34)48-29-37-26(38-40-29)22-9-6-16-45-22/h3-16,25H,2,17H2,1H3,(H,35,43)(H,36,44)(H,37,38,40) |
| InChIKey | KPGMTQXHYHUFTM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.86 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |