C20H38 — CID 123437991
1,1,2,2,3,3,4,5,6-nonamethyl-4-[(2-methylcyclopropyl)methyl]cyclohexane (PubChem CID 123437991) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5,6-nonamethyl-4-[(2-methylcyclopropyl)methyl]cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,5,6-nonamethyl-4-[(2-methylcyclopropyl)methyl]cyclohexane |
|---|---|
| PubChem CID | 123437991 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | 1,1,2,2,3,3,4,5,6-nonamethyl-4-[(2-methylcyclopropyl)methyl]cyclohexane |
| SMILES | CC1CC1CC1(C)C(C)C(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C20H38/c1-13-11-16(13)12-20(10)15(3)14(2)17(4,5)18(6,7)19(20,8)9/h13-16H,11-12H2,1-10H3 |
| InChIKey | WPKZTVPEITVZNR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |