About 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea
1-cyclohepta-1,3,6-trien-1-yl-3-methylurea (PubChem CID 123438413) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea.
Molecular Properties
| Compound Name | 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea |
| PubChem CID | 123438413 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea |
| SMILES | CNC(=O)NC1=CC=CCC=C1 |
| InChI | InChI=1S/C9H12N2O/c1-10-9(12)11-8-6-4-2-3-5-7-8/h2,4-7H,3H2,1H3,(H2,10,11,12) |
| InChIKey | SCDCXOIUMCJWPE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea?
The IUPAC name of 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea (CID 123438413) is 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea.
What is the SMILES notation for 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea?
The canonical SMILES for 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea is CNC(=O)NC1=CC=CCC=C1.
What is the InChIKey of 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea?
The InChIKey is SCDCXOIUMCJWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-10-9(12)11-8-6-4-2-3-5-7-8/h2,4-7H,3H2,1H3,(H2,10,11,12).
What are the key properties of 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea?
1-cyclohepta-1,3,6-trien-1-yl-3-methylurea has a molecular weight of 164.21 g/mol, XLogP of 1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohepta-1,3,6-trien-1-yl-3-methylurea is sourced from PubChem (CID 123438413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).