C34H35N7O5 — CID 123438477
N-[4-[3-[6-amino-7-(3-methoxy-4-phenylmethoxyphenyl)-8-oxopurin-9-yl]-N-methylanilino]-4-oxobut-2-enyl]-N-methylcyclopropanamine oxide (PubChem CID 123438477) has the molecular formula C34H35N7O5 and a molecular weight of 621.70 g/mol. Its IUPAC name is N-[4-[3-[6-amino-7-(3-methoxy-4-phenylmethoxyphenyl)-8-oxopurin-9-yl]-N-methylanilino]-4-oxobut-2-enyl]-N-methylcyclopropanamine oxide.
| Compound Name | N-[4-[3-[6-amino-7-(3-methoxy-4-phenylmethoxyphenyl)-8-oxopurin-9-yl]-N-methylanilino]-4-oxobut-2-enyl]-N-methylcyclopropanamine oxide |
|---|---|
| PubChem CID | 123438477 |
| Molecular Formula | C34H35N7O5 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.27 |
| IUPAC Name | N-[4-[3-[6-amino-7-(3-methoxy-4-phenylmethoxyphenyl)-8-oxopurin-9-yl]-N-methylanilino]-4-oxobut-2-enyl]-N-methylcyclopropanamine oxide |
| SMILES | COc1cc(-n2c(=O)n(-c3cccc(N(C)C(=O)C=CC[N+](C)([O-])C4CC4)c3)c3ncnc(N)c32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H35N7O5/c1-38(30(42)13-8-18-41(2,44)27-15-16-27)24-11-7-12-25(19-24)40-33-31(32(35)36-22-37-33)39(34(40)43)26-14-17-28(29(20-26)45-3)46-21-23-9-5-4-6-10-23/h4-14,17,19-20,22,27H,15-16,18,21H2,1-3H3,(H2,35,36,37) |
| InChIKey | HVRMPJRFIPECSZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|