C13H12F6N4O2S — CID 123438492
N-[(3-cyanophenyl)sulfonylamino]-N'-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)ethanimidamide (PubChem CID 123438492) has the molecular formula C13H12F6N4O2S and a molecular weight of 402.32 g/mol. Its IUPAC name is N-[(3-cyanophenyl)sulfonylamino]-N'-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)ethanimidamide.
| Compound Name | N-[(3-cyanophenyl)sulfonylamino]-N'-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 123438492 |
| Molecular Formula | C13H12F6N4O2S |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-[(3-cyanophenyl)sulfonylamino]-N'-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)ethanimidamide |
| SMILES | C/C(=N\C(C)(C(F)(F)F)C(F)(F)F)NNS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H12F6N4O2S/c1-8(21-11(2,12(14,15)16)13(17,18)19)22-23-26(24,25)10-5-3-4-9(6-10)7-20/h3-6,23H,1-2H3,(H,21,22) |
| InChIKey | RGFYHQXJIHSYHT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|