About 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran
4-ethylsulfanyl-5-methyl-2,3-dihydrofuran (PubChem CID 123438719) has the molecular formula C7H12OS
and a molecular weight of 144.24 g/mol. Its IUPAC name is 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran |
| PubChem CID | 123438719 |
| Molecular Formula | C7H12OS |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran |
| SMILES | CCSC1=C(C)OCC1 |
| InChI | InChI=1S/C7H12OS/c1-3-9-7-4-5-8-6(7)2/h3-5H2,1-2H3 |
| InChIKey | QOEOWDYBPOMFAS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran?
The IUPAC name of 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran (CID 123438719) is 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran.
What is the SMILES notation for 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran?
The canonical SMILES for 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran is CCSC1=C(C)OCC1.
What is the InChIKey of 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran?
The InChIKey is QOEOWDYBPOMFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS/c1-3-9-7-4-5-8-6(7)2/h3-5H2,1-2H3.
What are the key properties of 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran?
4-ethylsulfanyl-5-methyl-2,3-dihydrofuran has a molecular weight of 144.24 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-5-methyl-2,3-dihydrofuran is sourced from PubChem (CID 123438719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).