C26H20ClF3N2O4 — CID 123438923
6-[[6-chloro-5-(4-phenylphenyl)-3-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 123438923) has the molecular formula C26H20ClF3N2O4 and a molecular weight of 516.90 g/mol. Its IUPAC name is 6-[[6-chloro-5-(4-phenylphenyl)-3-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | 6-[[6-chloro-5-(4-phenylphenyl)-3-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 123438923 |
| Molecular Formula | C26H20ClF3N2O4 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 6-[[6-chloro-5-(4-phenylphenyl)-3-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | OC1COC2C(Oc3[nH]c4cc(Cl)c(-c5ccc(-c6ccccc6)cc5)nc4c3C(F)(F)F)COC12 |
| InChI | InChI=1S/C26H20ClF3N2O4/c27-16-10-17-22(32-21(16)15-8-6-14(7-9-15)13-4-2-1-3-5-13)20(26(28,29)30)25(31-17)36-19-12-35-23-18(33)11-34-24(19)23/h1-10,18-19,23-24,31,33H,11-12H2 |
| InChIKey | YOEUKRCADPNDLG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |