About 5-amino-1,2-dihydroindazole-3-thione
5-amino-1,2-dihydroindazole-3-thione (PubChem CID 123439109) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is 5-amino-1,2-dihydroindazole-3-thione.
Molecular Properties
| Compound Name | 5-amino-1,2-dihydroindazole-3-thione |
| PubChem CID | 123439109 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5-amino-1,2-dihydroindazole-3-thione |
| SMILES | Nc1ccc2[nH][nH]c(=S)c2c1 |
| InChI | InChI=1S/C7H7N3S/c8-4-1-2-6-5(3-4)7(11)10-9-6/h1-3H,8H2,(H2,9,10,11) |
| InChIKey | FFWHDDVRWCEBOK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,2-dihydroindazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,2-dihydroindazole-3-thione?
The IUPAC name of 5-amino-1,2-dihydroindazole-3-thione (CID 123439109) is 5-amino-1,2-dihydroindazole-3-thione.
What is the SMILES notation for 5-amino-1,2-dihydroindazole-3-thione?
The canonical SMILES for 5-amino-1,2-dihydroindazole-3-thione is Nc1ccc2[nH][nH]c(=S)c2c1.
What is the InChIKey of 5-amino-1,2-dihydroindazole-3-thione?
The InChIKey is FFWHDDVRWCEBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c8-4-1-2-6-5(3-4)7(11)10-9-6/h1-3H,8H2,(H2,9,10,11).
What are the key properties of 5-amino-1,2-dihydroindazole-3-thione?
5-amino-1,2-dihydroindazole-3-thione has a molecular weight of 165.22 g/mol, XLogP of 1.81, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,2-dihydroindazole-3-thione is sourced from PubChem (CID 123439109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).