C16H18N6S — CID 123439215
2-(3-ethanimidoyl-4-iminopentyl)-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione (PubChem CID 123439215) has the molecular formula C16H18N6S and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-(3-ethanimidoyl-4-iminopentyl)-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione.
| Compound Name | 2-(3-ethanimidoyl-4-iminopentyl)-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione |
|---|---|
| PubChem CID | 123439215 |
| Molecular Formula | C16H18N6S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(3-ethanimidoyl-4-iminopentyl)-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione |
| SMILES | [H]/N=C(\C)C(CCc1nc2c3ccccc3nc(=S)n2[nH]1)/C(C)=N/[H] |
| InChI | InChI=1S/C16H18N6S/c1-9(17)11(10(2)18)7-8-14-20-15-12-5-3-4-6-13(12)19-16(23)22(15)21-14/h3-6,11,17-18H,7-8H2,1-2H3,(H,20,21)/b17-9+,18-10+ |
| InChIKey | GSZZVQIZFWCBHF-BEQMOXJMSA-N |
| XLogP | 3.57 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|