About N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide
N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide (PubChem CID 123439330) has the molecular formula C18H35N3O2
and a molecular weight of 325.50 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide |
| PubChem CID | 123439330 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide |
| SMILES | CNN(CCCN(C)C)C(=O)C1CCCCC1C(=O)C(C)(C)C |
| InChI | InChI=1S/C18H35N3O2/c1-18(2,3)16(22)14-10-7-8-11-15(14)17(23)21(19-4)13-9-12-20(5)6/h14-15,19H,7-13H2,1-6H3 |
| InChIKey | UWTQTSXHTRCOSX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide?
The IUPAC name of N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide (CID 123439330) is N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide.
What is the SMILES notation for N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide?
The canonical SMILES for N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide is CNN(CCCN(C)C)C(=O)C1CCCCC1C(=O)C(C)(C)C.
What is the InChIKey of N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide?
The InChIKey is UWTQTSXHTRCOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N3O2/c1-18(2,3)16(22)14-10-7-8-11-15(14)17(23)21(19-4)13-9-12-20(5)6/h14-15,19H,7-13H2,1-6H3.
What are the key properties of N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide?
N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide has a molecular weight of 325.50 g/mol, XLogP of 2.32, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)propyl]-2-(2,2-dimethylpropanoyl)-N'-methylcyclohexane-1-carbohydrazide is sourced from PubChem (CID 123439330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).