C16H17N4O+ — CID 123439510
N-[3-(2,3-dimethyl-1H-pyrazolo[5,4-b]pyridin-2-ium-5-yl)phenyl]acetamide (PubChem CID 123439510) has the molecular formula C16H17N4O+ and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[3-(2,3-dimethyl-1H-pyrazolo[5,4-b]pyridin-2-ium-5-yl)phenyl]acetamide.
| Compound Name | N-[3-(2,3-dimethyl-1H-pyrazolo[5,4-b]pyridin-2-ium-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 123439510 |
| Molecular Formula | C16H17N4O+ |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[3-(2,3-dimethyl-1H-pyrazolo[5,4-b]pyridin-2-ium-5-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2cnc3[nH][n+](C)c(C)c3c2)c1 |
| InChI | InChI=1S/C16H16N4O/c1-10-15-8-13(9-17-16(15)19-20(10)3)12-5-4-6-14(7-12)18-11(2)21/h4-9H,1-3H3,(H,18,21)/p+1 |
| InChIKey | NCFRFZVSBHYQDI-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|