C16H16N5O3S2- — CID 123440136
5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-(2-hydroxyethyl)pyrimidin-2-yl]thiophene-2-sulfinate (PubChem CID 123440136) has the molecular formula C16H16N5O3S2- and a molecular weight of 390.47 g/mol. Its IUPAC name is 5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-(2-hydroxyethyl)pyrimidin-2-yl]thiophene-2-sulfinate.
| Compound Name | 5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-(2-hydroxyethyl)pyrimidin-2-yl]thiophene-2-sulfinate |
|---|---|
| PubChem CID | 123440136 |
| Molecular Formula | C16H16N5O3S2- |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-(2-hydroxyethyl)pyrimidin-2-yl]thiophene-2-sulfinate |
| SMILES | O=S([O-])c1ccc(-c2ncc(CCO)c(Nc3cc(C4CC4)[nH]n3)n2)s1 |
| InChI | InChI=1S/C16H17N5O3S2/c22-6-5-10-8-17-16(12-3-4-14(25-12)26(23)24)19-15(10)18-13-7-11(20-21-13)9-1-2-9/h3-4,7-9,22H,1-2,5-6H2,(H,23,24)(H2,17,18,19,20,21)/p-1 |
| InChIKey | LJVAQCFSHDMYHU-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|