C12H17Cl — CID 123440272
1-chloro-2-(2,3-dimethylbutyl)benzene (PubChem CID 123440272) has the molecular formula C12H17Cl and a molecular weight of 196.72 g/mol. Its IUPAC name is 1-chloro-2-(2,3-dimethylbutyl)benzene.
| Compound Name | 1-chloro-2-(2,3-dimethylbutyl)benzene |
|---|---|
| PubChem CID | 123440272 |
| Molecular Formula | C12H17Cl |
| Molecular Weight | 196.72 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-chloro-2-(2,3-dimethylbutyl)benzene |
| SMILES | CC(C)C(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C12H17Cl/c1-9(2)10(3)8-11-6-4-5-7-12(11)13/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | IBHNYEDXBXPPOQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |