C28H42N2 — CID 123440338
N-ethyl-N-methyl-3-[4-(1,7,12-trimethyl-3,4,6,7,10,11-hexahydrocyclodeca[c]pyridin-3-yl)cyclohexa-1,5-dien-1-yl]propan-1-amine (PubChem CID 123440338) has the molecular formula C28H42N2 and a molecular weight of 406.66 g/mol. Its IUPAC name is N-ethyl-N-methyl-3-[4-(1,7,12-trimethyl-3,4,6,7,10,11-hexahydrocyclodeca[c]pyridin-3-yl)cyclohexa-1,5-dien-1-yl]propan-1-amine.
| Compound Name | N-ethyl-N-methyl-3-[4-(1,7,12-trimethyl-3,4,6,7,10,11-hexahydrocyclodeca[c]pyridin-3-yl)cyclohexa-1,5-dien-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 123440338 |
| Molecular Formula | C28H42N2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | N-ethyl-N-methyl-3-[4-(1,7,12-trimethyl-3,4,6,7,10,11-hexahydrocyclodeca[c]pyridin-3-yl)cyclohexa-1,5-dien-1-yl]propan-1-amine |
| SMILES | CCN(C)CCCC1=CCC(C2CC3=CCC(C)C=CCCC(C)=C3C(C)=N2)C=C1 |
| InChI | InChI=1S/C28H42N2/c1-6-30(5)19-9-12-24-14-17-25(18-15-24)27-20-26-16-13-21(2)10-7-8-11-22(3)28(26)23(4)29-27/h7,10,14-17,21,25,27H,6,8-9,11-13,18-20H2,1-5H3 |
| InChIKey | FTZASYVTMHGRKC-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|