C19H26F3NO5S — CID 123440937
[(1S,3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]cyclohexyl]methanesulfonic acid (PubChem CID 123440937) has the molecular formula C19H26F3NO5S and a molecular weight of 437.48 g/mol. Its IUPAC name is [(1S,3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]cyclohexyl]methanesulfonic acid.
| Compound Name | [(1S,3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]cyclohexyl]methanesulfonic acid |
|---|---|
| PubChem CID | 123440937 |
| Molecular Formula | C19H26F3NO5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [(1S,3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]cyclohexyl]methanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](CS(=O)(=O)O)C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H26F3NO5S/c1-18(2,3)28-17(24)23-16-9-4-12(11-29(25,26)27)10-15(16)13-5-7-14(8-6-13)19(20,21)22/h5-8,12,15-16H,4,9-11H2,1-3H3,(H,23,24)(H,25,26,27)/t12-,15-,16+/m0/s1 |
| InChIKey | LWPQOLWZKGMZMS-VBNZEHGJSA-N |
| XLogP | 4.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|