C37H49F2NO4 — CID 123441154
4-[[3-[[3-butoxy-5-cyclopropyl-4-(2,4-difluoro-5-methylphenyl)phenyl]methyl]-2,4,5,8-tetrahydro-1,3-oxazocin-6-yl]methyl]-1-methylcycloheptane-1-carboxylic acid (PubChem CID 123441154) has the molecular formula C37H49F2NO4 and a molecular weight of 609.80 g/mol. Its IUPAC name is 4-[[3-[[3-butoxy-5-cyclopropyl-4-(2,4-difluoro-5-methylphenyl)phenyl]methyl]-2,4,5,8-tetrahydro-1,3-oxazocin-6-yl]methyl]-1-methylcycloheptane-1-carboxylic acid.
| Compound Name | 4-[[3-[[3-butoxy-5-cyclopropyl-4-(2,4-difluoro-5-methylphenyl)phenyl]methyl]-2,4,5,8-tetrahydro-1,3-oxazocin-6-yl]methyl]-1-methylcycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 123441154 |
| Molecular Formula | C37H49F2NO4 |
| Molecular Weight | 609.80 g/mol |
| Exact Mass | 609.36 |
| IUPAC Name | 4-[[3-[[3-butoxy-5-cyclopropyl-4-(2,4-difluoro-5-methylphenyl)phenyl]methyl]-2,4,5,8-tetrahydro-1,3-oxazocin-6-yl]methyl]-1-methylcycloheptane-1-carboxylic acid |
| SMILES | CCCCOc1cc(CN2CCC(CC3CCCC(C)(C(=O)O)CC3)=CCOC2)cc(C2CC2)c1-c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C37H49F2NO4/c1-4-5-16-44-34-21-28(20-30(29-8-9-29)35(34)31-18-25(2)32(38)22-33(31)39)23-40-15-11-27(12-17-43-24-40)19-26-7-6-13-37(3,14-10-26)36(41)42/h12,18,20-22,26,29H,4-11,13-17,19,23-24H2,1-3H3,(H,41,42) |
| InChIKey | NDMZWSGEZBYMCH-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.80 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|