C30H35F2N2O2+ — CID 123441171
[1-[(2,6-difluoro-3,4,5-trimethylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 123441171) has the molecular formula C30H35F2N2O2+ and a molecular weight of 493.62 g/mol. Its IUPAC name is [1-[(2,6-difluoro-3,4,5-trimethylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | [1-[(2,6-difluoro-3,4,5-trimethylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 123441171 |
| Molecular Formula | C30H35F2N2O2+ |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | [1-[(2,6-difluoro-3,4,5-trimethylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C[N+]2(Cc3c(F)c(C)c(C)c(C)c3F)CCC1CC2C(O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C30H35F2N2O2/c1-6-20-15-34(16-25-28(31)18(3)17(2)19(4)29(25)32)12-10-21(20)13-27(34)30(35)23-9-11-33-26-8-7-22(36-5)14-24(23)26/h6-9,11,14,20-21,27,30,35H,1,10,12-13,15-16H2,2-5H3/q+1 |
| InChIKey | KTTNAGVXSMHWMD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|