C11H20N2S — CID 123441329
2,4,7,9-tetramethyl-5,6,7,10-tetrahydro-2H-1,3,6-thiadiazecine (PubChem CID 123441329) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 2,4,7,9-tetramethyl-5,6,7,10-tetrahydro-2H-1,3,6-thiadiazecine.
| Compound Name | 2,4,7,9-tetramethyl-5,6,7,10-tetrahydro-2H-1,3,6-thiadiazecine |
|---|---|
| PubChem CID | 123441329 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2,4,7,9-tetramethyl-5,6,7,10-tetrahydro-2H-1,3,6-thiadiazecine |
| SMILES | CC1=CC(C)NCC(C)=NC(C)SC1 |
| InChI | InChI=1S/C11H20N2S/c1-8-5-9(2)12-6-10(3)13-11(4)14-7-8/h5,9,11-12H,6-7H2,1-4H3 |
| InChIKey | ZRUYQPZNDFAODG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|