C9H12BNO — CID 123441807
5-methylboranylidene-2,3,3a,7a-tetrahydro-1H-indol-4-one (PubChem CID 123441807) has the molecular formula C9H12BNO and a molecular weight of 161.01 g/mol. Its IUPAC name is 5-methylboranylidene-2,3,3a,7a-tetrahydro-1H-indol-4-one.
| Compound Name | 5-methylboranylidene-2,3,3a,7a-tetrahydro-1H-indol-4-one |
|---|---|
| PubChem CID | 123441807 |
| Molecular Formula | C9H12BNO |
| Molecular Weight | 161.01 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 5-methylboranylidene-2,3,3a,7a-tetrahydro-1H-indol-4-one |
| SMILES | C/B=C1\C=CC2NCCC2C1=O |
| InChI | InChI=1S/C9H12BNO/c1-10-7-2-3-8-6(9(7)12)4-5-11-8/h2-3,6,8,11H,4-5H2,1H3 |
| InChIKey | QAUHPOYENLBMOX-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.01 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|