C23H30BNO5 — CID 123441992
1-[[(5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-2-hydroxy-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione (PubChem CID 123441992) has the molecular formula C23H30BNO5 and a molecular weight of 411.31 g/mol. Its IUPAC name is 1-[[(5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-2-hydroxy-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione.
| Compound Name | 1-[[(5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-2-hydroxy-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
|---|---|
| PubChem CID | 123441992 |
| Molecular Formula | C23H30BNO5 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[[(5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-2-hydroxy-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
| SMILES | CC1(C)C2C[C@H]1CCC2C[N+]12CC(=O)C(C1)C(=O)O[B-]2(O)C1OC1c1ccccc1 |
| InChI | InChI=1S/C23H30BNO5/c1-23(2)16-9-8-15(18(23)10-16)11-25-12-17(19(26)13-25)22(27)30-24(25,28)21-20(29-21)14-6-4-3-5-7-14/h3-7,15-18,20-21,28H,8-13H2,1-2H3/t15?,16-,17?,18?,20?,21?,24?,25?/m1/s1 |
| InChIKey | ORNZDROLELJQKP-RQWZNHMJSA-N |
| XLogP | 2.24 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|