C35H26S6 — CID 123442068
5-butan-2-yl-12-methyl-4,11-bis(5-phenylthiophen-2-yl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene (PubChem CID 123442068) has the molecular formula C35H26S6 and a molecular weight of 639.00 g/mol. Its IUPAC name is 5-butan-2-yl-12-methyl-4,11-bis(5-phenylthiophen-2-yl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene.
| Compound Name | 5-butan-2-yl-12-methyl-4,11-bis(5-phenylthiophen-2-yl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene |
|---|---|
| PubChem CID | 123442068 |
| Molecular Formula | C35H26S6 |
| Molecular Weight | 639.00 g/mol |
| Exact Mass | 638.04 |
| IUPAC Name | 5-butan-2-yl-12-methyl-4,11-bis(5-phenylthiophen-2-yl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene |
| SMILES | CCC(C)c1c(-c2ccc(-c3ccccc3)s2)sc2c1sc1c3sc(-c4ccc(-c5ccccc5)s4)c(C)c3sc21 |
| InChI | InChI=1S/C35H26S6/c1-4-19(2)27-30(26-18-16-24(37-26)22-13-9-6-10-14-22)40-33-31(27)41-34-32-29(39-35(33)34)20(3)28(38-32)25-17-15-23(36-25)21-11-7-5-8-12-21/h5-19H,4H2,1-3H3 |
| InChIKey | KZZAALDEOVJVSV-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.00 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |