C16H22N4O4+2 — CID 123442098
7,15-dimethyl-1,5-diaza-9,13-diazoniatricyclo[11.3.1.15,9]octadeca-8,13-diene-6,16,17,18-tetrone (PubChem CID 123442098) has the molecular formula C16H22N4O4+2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 7,15-dimethyl-1,5-diaza-9,13-diazoniatricyclo[11.3.1.15,9]octadeca-8,13-diene-6,16,17,18-tetrone.
| Compound Name | 7,15-dimethyl-1,5-diaza-9,13-diazoniatricyclo[11.3.1.15,9]octadeca-8,13-diene-6,16,17,18-tetrone |
|---|---|
| PubChem CID | 123442098 |
| Molecular Formula | C16H22N4O4+2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 7,15-dimethyl-1,5-diaza-9,13-diazoniatricyclo[11.3.1.15,9]octadeca-8,13-diene-6,16,17,18-tetrone |
| SMILES | CC1C=[N+]2CCC[N+]3=CC(C)C(=O)N(CCCN(C1=O)C2=O)C3=O |
| InChI | InChI=1S/C16H22N4O4/c1-11-9-17-5-3-6-18-10-12(2)14(22)20(16(18)24)8-4-7-19(13(11)21)15(17)23/h9-12H,3-8H2,1-2H3/q+2 |
| InChIKey | NBECBSSKZDPGEI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|