C22H20N3+ — CID 123442180
3,12,17,21-tetramethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8,10,12,15(20),16,18-decaene (PubChem CID 123442180) has the molecular formula C22H20N3+ and a molecular weight of 326.42 g/mol. Its IUPAC name is 3,12,17,21-tetramethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8,10,12,15(20),16,18-decaene.
| Compound Name | 3,12,17,21-tetramethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8,10,12,15(20),16,18-decaene |
|---|---|
| PubChem CID | 123442180 |
| Molecular Formula | C22H20N3+ |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3,12,17,21-tetramethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8,10,12,15(20),16,18-decaene |
| SMILES | Cc1ccc2c(c1)n1c3c(C)cccc3c3nccc(C)c3c1[n+]2C |
| InChI | InChI=1S/C22H20N3/c1-13-8-9-17-18(12-13)25-21-15(3)6-5-7-16(21)20-19(22(25)24(17)4)14(2)10-11-23-20/h5-12H,1-4H3/q+1 |
| InChIKey | CJLQHWBXZDUMSD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|