C10H16N2O — CID 123442268
3-(2-aminoethyl)-1,2,3,3a,4,7a-hexahydroindol-5-one (PubChem CID 123442268) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1,2,3,3a,4,7a-hexahydroindol-5-one.
| Compound Name | 3-(2-aminoethyl)-1,2,3,3a,4,7a-hexahydroindol-5-one |
|---|---|
| PubChem CID | 123442268 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-(2-aminoethyl)-1,2,3,3a,4,7a-hexahydroindol-5-one |
| SMILES | NCCC1CNC2C=CC(=O)CC12 |
| InChI | InChI=1S/C10H16N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,7,9-10,12H,3-6,11H2 |
| InChIKey | UKFOYZTZQJUAIO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |