About 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile
2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile (PubChem CID 123442377) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile.
Analyze 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile?
The IUPAC name of 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile (CID 123442377) is 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile?
The canonical SMILES for 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile is CC1=NC(C)C(C#N)C=C1C#N.
What is the InChIKey of 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile?
The InChIKey is BAAYOOYAVOIUFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c1-6-8(4-10)3-9(5-11)7(2)12-6/h3,6,8H,1-2H3.
What are the key properties of 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile?
2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile has a molecular weight of 159.19 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2,3-dihydropyridine-3,5-dicarbonitrile is sourced from PubChem (CID 123442377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).