C41H44N6OS — CID 123442393
[4-[4-(5-methyl-2-phenylpyrazol-3-yl)piperazin-1-yl]-1-tritylpyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone (PubChem CID 123442393) has the molecular formula C41H44N6OS and a molecular weight of 668.91 g/mol. Its IUPAC name is [4-[4-(5-methyl-2-phenylpyrazol-3-yl)piperazin-1-yl]-1-tritylpyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone.
| Compound Name | [4-[4-(5-methyl-2-phenylpyrazol-3-yl)piperazin-1-yl]-1-tritylpyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 123442393 |
| Molecular Formula | C41H44N6OS |
| Molecular Weight | 668.91 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | [4-[4-(5-methyl-2-phenylpyrazol-3-yl)piperazin-1-yl]-1-tritylpyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone |
| SMILES | Cc1cc(N2CCN(C3CC(C(=O)N4CCSC4)N(C(c4ccccc4)(c4ccccc4)c4ccccc4)C3)CC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C41H44N6OS/c1-32-28-39(47(42-32)36-20-12-5-13-21-36)44-24-22-43(23-25-44)37-29-38(40(48)45-26-27-49-31-45)46(30-37)41(33-14-6-2-7-15-33,34-16-8-3-9-17-34)35-18-10-4-11-19-35/h2-21,28,37-38H,22-27,29-31H2,1H3 |
| InChIKey | PXFITXUJWIEXSB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 47.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.91 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|