(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid

C21H17BO3 — CID 123442682

IUPAC(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid
SMILESCC1(C)c2ccccc2-c2c1ccc1c2oc2c(B(O)O)cccc21
InChIInChI=1S/C21H17BO3/c1-21(2)15-8-4-3-6-14(15)18-16(21)11-10-13-12-7-5-9-17(22(23)24)19(12)25-20(13)18/h3-11,23-24H,1-2H3
InChIKeyQCHWBIDCEJAROF-UHFFFAOYSA-N
MW328.18 g/mol
LogP3.57
Rot. Bonds1

About (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid

(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid (PubChem CID 123442682) has the molecular formula C21H17BO3 and a molecular weight of 328.18 g/mol. Its IUPAC name is (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid.

Molecular Properties

Compound Name(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid
PubChem CID123442682
Molecular FormulaC21H17BO3
Molecular Weight328.18 g/mol
Exact Mass328.13
IUPAC Name(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid
SMILESCC1(C)c2ccccc2-c2c1ccc1c2oc2c(B(O)O)cccc21
InChIInChI=1S/C21H17BO3/c1-21(2)15-8-4-3-6-14(15)18-16(21)11-10-13-12-7-5-9-17(22(23)24)19(12)25-20(13)18/h3-11,23-24H,1-2H3
InChIKeyQCHWBIDCEJAROF-UHFFFAOYSA-N
XLogP3.57
TPSA53.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.18
LogP ≤ 53.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid?
The IUPAC name of (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid (CID 123442682) is (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid.
What is the SMILES notation for (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid?
The canonical SMILES for (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid is CC1(C)c2ccccc2-c2c1ccc1c2oc2c(B(O)O)cccc21.
What is the InChIKey of (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid?
The InChIKey is QCHWBIDCEJAROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17BO3/c1-21(2)15-8-4-3-6-14(15)18-16(21)11-10-13-12-7-5-9-17(22(23)24)19(12)25-20(13)18/h3-11,23-24H,1-2H3.
What are the key properties of (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid?
(7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid has a molecular weight of 328.18 g/mol, XLogP of 3.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7,7-dimethylfluoreno[4,3-b][1]benzofuran-1-yl)boronic acid is sourced from PubChem (CID 123442682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).