About 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine
4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine (PubChem CID 123442834) has the molecular formula C9H13F2NO
and a molecular weight of 189.20 g/mol. Its IUPAC name is 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine.
Molecular Properties
| Compound Name | 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine |
| PubChem CID | 123442834 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine |
| SMILES | C=C(F)C(=CF)OC1CCNCC1 |
| InChI | InChI=1S/C9H13F2NO/c1-7(11)9(6-10)13-8-2-4-12-5-3-8/h6,8,12H,1-5H2 |
| InChIKey | IKLACTUOLKEDRC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine?
The IUPAC name of 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine (CID 123442834) is 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine.
What is the SMILES notation for 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine?
The canonical SMILES for 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine is C=C(F)C(=CF)OC1CCNCC1.
What is the InChIKey of 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine?
The InChIKey is IKLACTUOLKEDRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO/c1-7(11)9(6-10)13-8-2-4-12-5-3-8/h6,8,12H,1-5H2.
What are the key properties of 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine?
4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine has a molecular weight of 189.20 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-difluorobuta-1,3-dien-2-yloxy)piperidine is sourced from PubChem (CID 123442834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).