About (6Z,15Z)-11-isocyanohenicosa-6,15-diene
(6Z,15Z)-11-isocyanohenicosa-6,15-diene (PubChem CID 123442851) has the molecular formula C22H39N
and a molecular weight of 317.56 g/mol. Its IUPAC name is (6Z,15Z)-11-isocyanohenicosa-6,15-diene.
Molecular Properties
| Compound Name | (6Z,15Z)-11-isocyanohenicosa-6,15-diene |
| PubChem CID | 123442851 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | (6Z,15Z)-11-isocyanohenicosa-6,15-diene |
| SMILES | [C-]#[N+]C(CCC/C=C\CCCCC)CCC/C=C\CCCCC |
| InChI | InChI=1S/C22H39N/c1-4-6-8-10-12-14-16-18-20-22(23-3)21-19-17-15-13-11-9-7-5-2/h12-15,22H,4-11,16-21H2,1-2H3/b14-12-,15-13- |
| InChIKey | DABZBBANSRCAOW-DZDAAMPGSA-N |
| XLogP | 7.89 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6Z,15Z)-11-isocyanohenicosa-6,15-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,15Z)-11-isocyanohenicosa-6,15-diene?
The IUPAC name of (6Z,15Z)-11-isocyanohenicosa-6,15-diene (CID 123442851) is (6Z,15Z)-11-isocyanohenicosa-6,15-diene.
What is the SMILES notation for (6Z,15Z)-11-isocyanohenicosa-6,15-diene?
The canonical SMILES for (6Z,15Z)-11-isocyanohenicosa-6,15-diene is [C-]#[N+]C(CCC/C=C\CCCCC)CCC/C=C\CCCCC.
What is the InChIKey of (6Z,15Z)-11-isocyanohenicosa-6,15-diene?
The InChIKey is DABZBBANSRCAOW-DZDAAMPGSA-N. The full InChI is InChI=1S/C22H39N/c1-4-6-8-10-12-14-16-18-20-22(23-3)21-19-17-15-13-11-9-7-5-2/h12-15,22H,4-11,16-21H2,1-2H3/b14-12-,15-13-.
What are the key properties of (6Z,15Z)-11-isocyanohenicosa-6,15-diene?
(6Z,15Z)-11-isocyanohenicosa-6,15-diene has a molecular weight of 317.56 g/mol, XLogP of 7.89, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,15Z)-11-isocyanohenicosa-6,15-diene is sourced from PubChem (CID 123442851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).