C11H22N2 — CID 123443027
1-N,1-N'-dimethyl-1-N'-(4-methylcyclohexen-1-yl)ethane-1,1-diamine (PubChem CID 123443027) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-N,1-N'-dimethyl-1-N'-(4-methylcyclohexen-1-yl)ethane-1,1-diamine.
| Compound Name | 1-N,1-N'-dimethyl-1-N'-(4-methylcyclohexen-1-yl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 123443027 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-N,1-N'-dimethyl-1-N'-(4-methylcyclohexen-1-yl)ethane-1,1-diamine |
| SMILES | CNC(C)N(C)C1=CCC(C)CC1 |
| InChI | InChI=1S/C11H22N2/c1-9-5-7-11(8-6-9)13(4)10(2)12-3/h7,9-10,12H,5-6,8H2,1-4H3 |
| InChIKey | KZQRUEKHLMBHAJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|