C38H34N6O5S — CID 123443117
5-[1-(benzenesulfonyl)-2-[4-[4-(2-isocyanoacetyl)piperazin-1-yl]phenyl]pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 123443117) has the molecular formula C38H34N6O5S and a molecular weight of 686.79 g/mol. Its IUPAC name is 5-[1-(benzenesulfonyl)-2-[4-[4-(2-isocyanoacetyl)piperazin-1-yl]phenyl]pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[1-(benzenesulfonyl)-2-[4-[4-(2-isocyanoacetyl)piperazin-1-yl]phenyl]pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 123443117 |
| Molecular Formula | C38H34N6O5S |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 686.23 |
| IUPAC Name | 5-[1-(benzenesulfonyl)-2-[4-[4-(2-isocyanoacetyl)piperazin-1-yl]phenyl]pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | [C-]#[N+]CC(=O)N1CCN(c2ccc(-c3cc4c(-c5ccc(OC6CCOCC6)c(C#N)c5)ccnc4n3S(=O)(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C38H34N6O5S/c1-40-26-37(45)43-19-17-42(18-20-43)30-10-7-27(8-11-30)35-24-34-33(13-16-41-38(34)44(35)50(46,47)32-5-3-2-4-6-32)28-9-12-36(29(23-28)25-39)49-31-14-21-48-22-15-31/h2-13,16,23-24,31H,14-15,17-22,26H2 |
| InChIKey | BUAUKCLHUPDBFO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 122.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|