C31H47N7O5 — CID 123443696
2-[2-cyclohexyl-2-[2-(diaminomethylideneamino)propanoylamino]acetyl]-N-(3,4-dihydro-2H-chromen-4-yl)-7-ethoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 123443696) has the molecular formula C31H47N7O5 and a molecular weight of 597.76 g/mol. Its IUPAC name is 2-[2-cyclohexyl-2-[2-(diaminomethylideneamino)propanoylamino]acetyl]-N-(3,4-dihydro-2H-chromen-4-yl)-7-ethoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | 2-[2-cyclohexyl-2-[2-(diaminomethylideneamino)propanoylamino]acetyl]-N-(3,4-dihydro-2H-chromen-4-yl)-7-ethoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 123443696 |
| Molecular Formula | C31H47N7O5 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | 2-[2-cyclohexyl-2-[2-(diaminomethylideneamino)propanoylamino]acetyl]-N-(3,4-dihydro-2H-chromen-4-yl)-7-ethoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | CCOC1CC2CN(C(=O)C(NC(=O)C(C)N=C(N)N)C3CCCCC3)C(C(=O)NC3CCOc4ccccc43)CN2C1 |
| InChI | InChI=1S/C31H47N7O5/c1-3-42-22-15-21-16-38(30(41)27(20-9-5-4-6-10-20)36-28(39)19(2)34-31(32)33)25(18-37(21)17-22)29(40)35-24-13-14-43-26-12-8-7-11-23(24)26/h7-8,11-12,19-22,24-25,27H,3-6,9-10,13-18H2,1-2H3,(H,35,40)(H,36,39)(H4,32,33,34) |
| InChIKey | CITHCWDCDWWMFI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|