About N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine
N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine (PubChem CID 123443910) has the molecular formula C18H22N2S2
and a molecular weight of 330.52 g/mol. Its IUPAC name is N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine.
Molecular Properties
| Compound Name | N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine |
| PubChem CID | 123443910 |
| Molecular Formula | C18H22N2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine |
| SMILES | Cc1ncc(-c2ccc(CNC34CC5CC(CC3C5)C4)s2)s1 |
| InChI | InChI=1S/C18H22N2S2/c1-11-19-10-17(21-11)16-3-2-15(22-16)9-20-18-7-12-4-13(8-18)6-14(18)5-12/h2-3,10,12-14,20H,4-9H2,1H3 |
| InChIKey | QREWWFYTEGVLQA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine?
The IUPAC name of N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine (CID 123443910) is N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine.
What is the SMILES notation for N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine?
The canonical SMILES for N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine is Cc1ncc(-c2ccc(CNC34CC5CC(CC3C5)C4)s2)s1.
What is the InChIKey of N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine?
The InChIKey is QREWWFYTEGVLQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2S2/c1-11-19-10-17(21-11)16-3-2-15(22-16)9-20-18-7-12-4-13(8-18)6-14(18)5-12/h2-3,10,12-14,20H,4-9H2,1H3.
What are the key properties of N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine?
N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine has a molecular weight of 330.52 g/mol, XLogP of 4.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(2-methyl-1,3-thiazol-5-yl)thiophen-2-yl]methyl]tricyclo[3.3.1.03,7]nonan-3-amine is sourced from PubChem (CID 123443910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).